N-[3-(4-ethylpiperazin-1-yl)propyl]-3-methyl-1-(4-methylphenyl)-5-(1H-pyrrol-1-yl)-1H-pyrazole-4-carboxamide
Chemical Structure Depiction of
N-[3-(4-ethylpiperazin-1-yl)propyl]-3-methyl-1-(4-methylphenyl)-5-(1H-pyrrol-1-yl)-1H-pyrazole-4-carboxamide
N-[3-(4-ethylpiperazin-1-yl)propyl]-3-methyl-1-(4-methylphenyl)-5-(1H-pyrrol-1-yl)-1H-pyrazole-4-carboxamide
Compound characteristics
| Compound ID: | E751-3760 |
| Compound Name: | N-[3-(4-ethylpiperazin-1-yl)propyl]-3-methyl-1-(4-methylphenyl)-5-(1H-pyrrol-1-yl)-1H-pyrazole-4-carboxamide |
| Molecular Weight: | 434.58 |
| Molecular Formula: | C25 H34 N6 O |
| Smiles: | CCN1CCN(CCCNC(c2c(C)nn(c3ccc(C)cc3)c2n2cccc2)=O)CC1 |
| Stereo: | ACHIRAL |
| logP: | 2.6856 |
| logD: | 1.7373 |
| logSw: | -2.8842 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 49.222 |
| InChI Key: | IYCVVEWDRLLUDC-UHFFFAOYSA-N |