N-[4-(diethylamino)-2-methylphenyl]-1-(4-fluorophenyl)-3-methyl-5-(1H-pyrrol-1-yl)-1H-pyrazole-4-carboxamide
Chemical Structure Depiction of
N-[4-(diethylamino)-2-methylphenyl]-1-(4-fluorophenyl)-3-methyl-5-(1H-pyrrol-1-yl)-1H-pyrazole-4-carboxamide
N-[4-(diethylamino)-2-methylphenyl]-1-(4-fluorophenyl)-3-methyl-5-(1H-pyrrol-1-yl)-1H-pyrazole-4-carboxamide
Compound characteristics
| Compound ID: | E751-4898 |
| Compound Name: | N-[4-(diethylamino)-2-methylphenyl]-1-(4-fluorophenyl)-3-methyl-5-(1H-pyrrol-1-yl)-1H-pyrazole-4-carboxamide |
| Molecular Weight: | 445.54 |
| Molecular Formula: | C26 H28 F N5 O |
| Smiles: | CCN(CC)c1ccc(c(C)c1)NC(c1c(C)nn(c2ccc(cc2)F)c1n1cccc1)=O |
| Stereo: | ACHIRAL |
| logP: | 5.274 |
| logD: | 5.0647 |
| logSw: | -5.1962 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 42.578 |
| InChI Key: | JPORPHTYGMSVRX-UHFFFAOYSA-N |