9-(4-methoxyphenyl)-4-phenyl-9,10-dihydro-2H,8H-pyrano[2,3-f][1,3]benzoxazin-2-one
Chemical Structure Depiction of
9-(4-methoxyphenyl)-4-phenyl-9,10-dihydro-2H,8H-pyrano[2,3-f][1,3]benzoxazin-2-one
9-(4-methoxyphenyl)-4-phenyl-9,10-dihydro-2H,8H-pyrano[2,3-f][1,3]benzoxazin-2-one
Compound characteristics
| Compound ID: | E754-0170 |
| Compound Name: | 9-(4-methoxyphenyl)-4-phenyl-9,10-dihydro-2H,8H-pyrano[2,3-f][1,3]benzoxazin-2-one |
| Molecular Weight: | 385.42 |
| Molecular Formula: | C24 H19 N O4 |
| Smiles: | COc1ccc(cc1)N1Cc2c(ccc3C(=CC(=O)Oc23)c2ccccc2)OC1 |
| Stereo: | ACHIRAL |
| logP: | 4.8005 |
| logD: | 4.8005 |
| logSw: | -4.741 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 39.907 |
| InChI Key: | CEWVVOTZXUEIQM-UHFFFAOYSA-N |