N-(4-ethoxyphenyl)-5-methoxy-1-methyl-3-(2-oxopyrrolidin-1-yl)-1H-indole-2-carboxamide
Chemical Structure Depiction of
N-(4-ethoxyphenyl)-5-methoxy-1-methyl-3-(2-oxopyrrolidin-1-yl)-1H-indole-2-carboxamide
N-(4-ethoxyphenyl)-5-methoxy-1-methyl-3-(2-oxopyrrolidin-1-yl)-1H-indole-2-carboxamide
Compound characteristics
| Compound ID: | E756-0383 |
| Compound Name: | N-(4-ethoxyphenyl)-5-methoxy-1-methyl-3-(2-oxopyrrolidin-1-yl)-1H-indole-2-carboxamide |
| Molecular Weight: | 407.47 |
| Molecular Formula: | C23 H25 N3 O4 |
| Smiles: | CCOc1ccc(cc1)NC(c1c(c2cc(ccc2n1C)OC)N1CCCC1=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.8813 |
| logD: | 3.8812 |
| logSw: | -4.0442 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 55.523 |
| InChI Key: | DDVFNBDDZPOPNN-UHFFFAOYSA-N |