5-methoxy-1-methyl-N-{[4-(methylsulfanyl)phenyl]methyl}-3-(2-oxopyrrolidin-1-yl)-1H-indole-2-carboxamide
Chemical Structure Depiction of
5-methoxy-1-methyl-N-{[4-(methylsulfanyl)phenyl]methyl}-3-(2-oxopyrrolidin-1-yl)-1H-indole-2-carboxamide
5-methoxy-1-methyl-N-{[4-(methylsulfanyl)phenyl]methyl}-3-(2-oxopyrrolidin-1-yl)-1H-indole-2-carboxamide
Compound characteristics
| Compound ID: | E756-0621 |
| Compound Name: | 5-methoxy-1-methyl-N-{[4-(methylsulfanyl)phenyl]methyl}-3-(2-oxopyrrolidin-1-yl)-1H-indole-2-carboxamide |
| Molecular Weight: | 423.53 |
| Molecular Formula: | C23 H25 N3 O3 S |
| Smiles: | Cn1c(C(NCc2ccc(cc2)SC)=O)c(c2cc(ccc12)OC)N1CCCC1=O |
| Stereo: | ACHIRAL |
| logP: | 3.8229 |
| logD: | 3.8229 |
| logSw: | -4.1354 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 49.722 |
| InChI Key: | FCKNTJIOOKWKHK-UHFFFAOYSA-N |