[4-(4-fluorophenyl)piperazin-1-yl][3-(2-methyl-3H-imidazo[4,5-b]pyridin-3-yl)phenyl]methanone
Chemical Structure Depiction of
[4-(4-fluorophenyl)piperazin-1-yl][3-(2-methyl-3H-imidazo[4,5-b]pyridin-3-yl)phenyl]methanone
[4-(4-fluorophenyl)piperazin-1-yl][3-(2-methyl-3H-imidazo[4,5-b]pyridin-3-yl)phenyl]methanone
Compound characteristics
| Compound ID: | E760-5381 |
| Compound Name: | [4-(4-fluorophenyl)piperazin-1-yl][3-(2-methyl-3H-imidazo[4,5-b]pyridin-3-yl)phenyl]methanone |
| Molecular Weight: | 415.47 |
| Molecular Formula: | C24 H22 F N5 O |
| Smiles: | Cc1nc2cccnc2n1c1cccc(c1)C(N1CCN(CC1)c1ccc(cc1)F)=O |
| Stereo: | ACHIRAL |
| logP: | 3.0072 |
| logD: | 3.007 |
| logSw: | -3.0372 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 41.503 |
| InChI Key: | BXAXAVIUSLDKNE-UHFFFAOYSA-N |