N-{[1-ethyl-2-(thiophen-2-yl)-1H-indol-3-yl]methyl}-N-(2-methoxyethyl)-N'-(2-methylphenyl)urea
Chemical Structure Depiction of
N-{[1-ethyl-2-(thiophen-2-yl)-1H-indol-3-yl]methyl}-N-(2-methoxyethyl)-N'-(2-methylphenyl)urea
N-{[1-ethyl-2-(thiophen-2-yl)-1H-indol-3-yl]methyl}-N-(2-methoxyethyl)-N'-(2-methylphenyl)urea
Compound characteristics
| Compound ID: | E769-1042 |
| Compound Name: | N-{[1-ethyl-2-(thiophen-2-yl)-1H-indol-3-yl]methyl}-N-(2-methoxyethyl)-N'-(2-methylphenyl)urea |
| Molecular Weight: | 447.6 |
| Molecular Formula: | C26 H29 N3 O2 S |
| Smiles: | CCn1c(c(CN(CCOC)C(Nc2ccccc2C)=O)c2ccccc12)c1cccs1 |
| Stereo: | ACHIRAL |
| logP: | 5.7223 |
| logD: | 5.7223 |
| logSw: | -5.606 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 33.866 |
| InChI Key: | ZHILFHLQRADEPE-UHFFFAOYSA-N |