N-(2,3-dimethylphenyl)-N'-{[1-ethyl-2-(thiophen-2-yl)-1H-indol-3-yl]methyl}urea
Chemical Structure Depiction of
N-(2,3-dimethylphenyl)-N'-{[1-ethyl-2-(thiophen-2-yl)-1H-indol-3-yl]methyl}urea
N-(2,3-dimethylphenyl)-N'-{[1-ethyl-2-(thiophen-2-yl)-1H-indol-3-yl]methyl}urea
Compound characteristics
| Compound ID: | E769-1294 |
| Compound Name: | N-(2,3-dimethylphenyl)-N'-{[1-ethyl-2-(thiophen-2-yl)-1H-indol-3-yl]methyl}urea |
| Molecular Weight: | 403.55 |
| Molecular Formula: | C24 H25 N3 O S |
| Smiles: | CCn1c(c(CNC(Nc2cccc(C)c2C)=O)c2ccccc12)c1cccs1 |
| Stereo: | ACHIRAL |
| logP: | 6.1983 |
| logD: | 6.1983 |
| logSw: | -5.7617 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 34.139 |
| InChI Key: | OJTXPGFMEHACAF-UHFFFAOYSA-N |