N-{[1-benzyl-2-(thiophen-2-yl)-1H-indol-3-yl]methyl}-N'-(5-chloro-2-methylphenyl)urea
Chemical Structure Depiction of
N-{[1-benzyl-2-(thiophen-2-yl)-1H-indol-3-yl]methyl}-N'-(5-chloro-2-methylphenyl)urea
N-{[1-benzyl-2-(thiophen-2-yl)-1H-indol-3-yl]methyl}-N'-(5-chloro-2-methylphenyl)urea
Compound characteristics
| Compound ID: | E769-1388 |
| Compound Name: | N-{[1-benzyl-2-(thiophen-2-yl)-1H-indol-3-yl]methyl}-N'-(5-chloro-2-methylphenyl)urea |
| Molecular Weight: | 486.03 |
| Molecular Formula: | C28 H24 Cl N3 O S |
| Smiles: | Cc1ccc(cc1NC(NCc1c2ccccc2n(Cc2ccccc2)c1c1cccs1)=O)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 7.189 |
| logD: | 7.189 |
| logSw: | -6.2954 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 34.143 |
| InChI Key: | WRSNIJVQKLTZTM-UHFFFAOYSA-N |