4-(5-methyl-4-{[(4-methylphenyl)sulfanyl]methyl}-1,3-oxazol-2-yl)-N-(4-methylphenyl)benzamide
Chemical Structure Depiction of
4-(5-methyl-4-{[(4-methylphenyl)sulfanyl]methyl}-1,3-oxazol-2-yl)-N-(4-methylphenyl)benzamide
4-(5-methyl-4-{[(4-methylphenyl)sulfanyl]methyl}-1,3-oxazol-2-yl)-N-(4-methylphenyl)benzamide
Compound characteristics
| Compound ID: | E776-0124 |
| Compound Name: | 4-(5-methyl-4-{[(4-methylphenyl)sulfanyl]methyl}-1,3-oxazol-2-yl)-N-(4-methylphenyl)benzamide |
| Molecular Weight: | 428.55 |
| Molecular Formula: | C26 H24 N2 O2 S |
| Smiles: | Cc1ccc(cc1)NC(c1ccc(cc1)c1nc(CSc2ccc(C)cc2)c(C)o1)=O |
| Stereo: | ACHIRAL |
| logP: | 6.4191 |
| logD: | 6.419 |
| logSw: | -5.653 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 41.18 |
| InChI Key: | YRZCUHXOXHWATG-UHFFFAOYSA-N |