4-{4-[(benzenesulfonyl)methyl]-5-methyl-1,3-oxazol-2-yl}-N-[(2-methylphenyl)methyl]benzamide
Chemical Structure Depiction of
4-{4-[(benzenesulfonyl)methyl]-5-methyl-1,3-oxazol-2-yl}-N-[(2-methylphenyl)methyl]benzamide
4-{4-[(benzenesulfonyl)methyl]-5-methyl-1,3-oxazol-2-yl}-N-[(2-methylphenyl)methyl]benzamide
Compound characteristics
| Compound ID: | E776-1941 |
| Compound Name: | 4-{4-[(benzenesulfonyl)methyl]-5-methyl-1,3-oxazol-2-yl}-N-[(2-methylphenyl)methyl]benzamide |
| Molecular Weight: | 460.55 |
| Molecular Formula: | C26 H24 N2 O4 S |
| Smiles: | Cc1ccccc1CNC(c1ccc(cc1)c1nc(CS(c2ccccc2)(=O)=O)c(C)o1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.5859 |
| logD: | 4.5858 |
| logSw: | -4.3606 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 71.538 |
| InChI Key: | ZTUXFBKEZFLAMG-UHFFFAOYSA-N |