methyl {6-[(2,4-dimethoxyphenyl)sulfamoyl]-3-oxo-2,3-dihydro-4H-1,4-benzothiazin-4-yl}acetate
Chemical Structure Depiction of
methyl {6-[(2,4-dimethoxyphenyl)sulfamoyl]-3-oxo-2,3-dihydro-4H-1,4-benzothiazin-4-yl}acetate
methyl {6-[(2,4-dimethoxyphenyl)sulfamoyl]-3-oxo-2,3-dihydro-4H-1,4-benzothiazin-4-yl}acetate
Compound characteristics
| Compound ID: | E786-1055 |
| Compound Name: | methyl {6-[(2,4-dimethoxyphenyl)sulfamoyl]-3-oxo-2,3-dihydro-4H-1,4-benzothiazin-4-yl}acetate |
| Molecular Weight: | 452.5 |
| Molecular Formula: | C19 H20 N2 O7 S2 |
| Smiles: | COC(CN1C(CSc2ccc(cc12)S(Nc1ccc(cc1OC)OC)(=O)=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.0296 |
| logD: | 1.3841 |
| logSw: | -2.8975 |
| Hydrogen bond acceptors count: | 12 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 91.595 |
| InChI Key: | YREXXGXOKPNCFT-UHFFFAOYSA-N |