methyl [3-oxo-6-(4-phenylpiperazine-1-sulfonyl)-2,3-dihydro-4H-1,4-benzothiazin-4-yl]acetate
Chemical Structure Depiction of
methyl [3-oxo-6-(4-phenylpiperazine-1-sulfonyl)-2,3-dihydro-4H-1,4-benzothiazin-4-yl]acetate
methyl [3-oxo-6-(4-phenylpiperazine-1-sulfonyl)-2,3-dihydro-4H-1,4-benzothiazin-4-yl]acetate
Compound characteristics
| Compound ID: | E786-1118 |
| Compound Name: | methyl [3-oxo-6-(4-phenylpiperazine-1-sulfonyl)-2,3-dihydro-4H-1,4-benzothiazin-4-yl]acetate |
| Molecular Weight: | 461.56 |
| Molecular Formula: | C21 H23 N3 O5 S2 |
| Smiles: | COC(CN1C(CSc2ccc(cc12)S(N1CCN(CC1)c1ccccc1)(=O)=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.4107 |
| logD: | 2.4107 |
| logSw: | -2.8404 |
| Hydrogen bond acceptors count: | 11 |
| Polar surface area: | 71.441 |
| InChI Key: | OPHGLLHKOOALBD-UHFFFAOYSA-N |