methyl {6-[(3-chloro-4-methylphenyl)sulfamoyl]-3-oxo-2,3-dihydro-4H-1,4-benzothiazin-4-yl}acetate
Chemical Structure Depiction of
methyl {6-[(3-chloro-4-methylphenyl)sulfamoyl]-3-oxo-2,3-dihydro-4H-1,4-benzothiazin-4-yl}acetate
methyl {6-[(3-chloro-4-methylphenyl)sulfamoyl]-3-oxo-2,3-dihydro-4H-1,4-benzothiazin-4-yl}acetate
Compound characteristics
| Compound ID: | E786-1135 |
| Compound Name: | methyl {6-[(3-chloro-4-methylphenyl)sulfamoyl]-3-oxo-2,3-dihydro-4H-1,4-benzothiazin-4-yl}acetate |
| Molecular Weight: | 440.92 |
| Molecular Formula: | C18 H17 Cl N2 O5 S2 |
| Smiles: | Cc1ccc(cc1[Cl])NS(c1ccc2c(c1)N(CC(=O)OC)C(CS2)=O)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.629 |
| logD: | 2.7959 |
| logSw: | -3.8712 |
| Hydrogen bond acceptors count: | 10 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 77.119 |
| InChI Key: | CWGJSQTYBJNHGZ-UHFFFAOYSA-N |