methyl {3-oxo-6-[(1,2,3,4-tetrahydronaphthalen-1-yl)sulfamoyl]-2,3-dihydro-4H-1,4-benzothiazin-4-yl}acetate
Chemical Structure Depiction of
methyl {3-oxo-6-[(1,2,3,4-tetrahydronaphthalen-1-yl)sulfamoyl]-2,3-dihydro-4H-1,4-benzothiazin-4-yl}acetate
methyl {3-oxo-6-[(1,2,3,4-tetrahydronaphthalen-1-yl)sulfamoyl]-2,3-dihydro-4H-1,4-benzothiazin-4-yl}acetate
Compound characteristics
| Compound ID: | E786-1175 |
| Compound Name: | methyl {3-oxo-6-[(1,2,3,4-tetrahydronaphthalen-1-yl)sulfamoyl]-2,3-dihydro-4H-1,4-benzothiazin-4-yl}acetate |
| Molecular Weight: | 446.54 |
| Molecular Formula: | C21 H22 N2 O5 S2 |
| Smiles: | COC(CN1C(CSc2ccc(cc12)S(NC1CCCc2ccccc12)(=O)=O)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.2891 |
| logD: | 3.2882 |
| logSw: | -3.7991 |
| Hydrogen bond acceptors count: | 11 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 78.285 |
| InChI Key: | XTOHVEWWFIZUHB-KRWDZBQOSA-N |