ethyl 2,5-dimethyl-1-({4-[(4-methyl-1,3-thiazol-2-yl)carbamoyl]cyclohexyl}methyl)-1H-pyrrole-3-carboxylate
Chemical Structure Depiction of
ethyl 2,5-dimethyl-1-({4-[(4-methyl-1,3-thiazol-2-yl)carbamoyl]cyclohexyl}methyl)-1H-pyrrole-3-carboxylate
ethyl 2,5-dimethyl-1-({4-[(4-methyl-1,3-thiazol-2-yl)carbamoyl]cyclohexyl}methyl)-1H-pyrrole-3-carboxylate
Compound characteristics
| Compound ID: | E786-1260 |
| Compound Name: | ethyl 2,5-dimethyl-1-({4-[(4-methyl-1,3-thiazol-2-yl)carbamoyl]cyclohexyl}methyl)-1H-pyrrole-3-carboxylate |
| Molecular Weight: | 403.54 |
| Molecular Formula: | C21 H29 N3 O3 S |
| Smiles: | CCOC(c1cc(C)n(CC2CCC(CC2)C(Nc2nc(C)cs2)=O)c1C)=O |
| Stereo: | ACHIRAL |
| logP: | 4.4874 |
| logD: | 4.456 |
| logSw: | -4.2503 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 56.05 |
| InChI Key: | WQFVLKXFXOXQMZ-UHFFFAOYSA-N |