ethyl 1-[(4-{[(4-methoxyphenyl)methyl]carbamoyl}cyclohexyl)methyl]-2,5-dimethyl-1H-pyrrole-3-carboxylate
Chemical Structure Depiction of
ethyl 1-[(4-{[(4-methoxyphenyl)methyl]carbamoyl}cyclohexyl)methyl]-2,5-dimethyl-1H-pyrrole-3-carboxylate
ethyl 1-[(4-{[(4-methoxyphenyl)methyl]carbamoyl}cyclohexyl)methyl]-2,5-dimethyl-1H-pyrrole-3-carboxylate
Compound characteristics
| Compound ID: | E786-1314 |
| Compound Name: | ethyl 1-[(4-{[(4-methoxyphenyl)methyl]carbamoyl}cyclohexyl)methyl]-2,5-dimethyl-1H-pyrrole-3-carboxylate |
| Molecular Weight: | 426.56 |
| Molecular Formula: | C25 H34 N2 O4 |
| Smiles: | CCOC(c1cc(C)n(CC2CCC(CC2)C(NCc2ccc(cc2)OC)=O)c1C)=O |
| Stereo: | ACHIRAL |
| logP: | 4.4212 |
| logD: | 4.4212 |
| logSw: | -4.2676 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 55.063 |
| InChI Key: | HZQRCEXHXBJJGZ-UHFFFAOYSA-N |