5-[(5,7-dioxo-5,7-dihydro-6H-pyrrolo[3,4-b]pyridin-6-yl)methyl]-N-(3-fluoro-4-methylphenyl)thiophene-2-sulfonamide
					Chemical Structure Depiction of
5-[(5,7-dioxo-5,7-dihydro-6H-pyrrolo[3,4-b]pyridin-6-yl)methyl]-N-(3-fluoro-4-methylphenyl)thiophene-2-sulfonamide
			5-[(5,7-dioxo-5,7-dihydro-6H-pyrrolo[3,4-b]pyridin-6-yl)methyl]-N-(3-fluoro-4-methylphenyl)thiophene-2-sulfonamide
Compound characteristics
| Compound ID: | E786-2000 | 
| Compound Name: | 5-[(5,7-dioxo-5,7-dihydro-6H-pyrrolo[3,4-b]pyridin-6-yl)methyl]-N-(3-fluoro-4-methylphenyl)thiophene-2-sulfonamide | 
| Molecular Weight: | 431.46 | 
| Molecular Formula: | C19 H14 F N3 O4 S2 | 
| Smiles: | Cc1ccc(cc1F)NS(c1ccc(CN2C(c3cccnc3C2=O)=O)s1)(=O)=O | 
| Stereo: | ACHIRAL | 
| logP: | 2.6857 | 
| logD: | 2.4787 | 
| logSw: | -3.2975 | 
| Hydrogen bond acceptors count: | 9 | 
| Hydrogen bond donors count: | 1 | 
| Polar surface area: | 81.068 | 
| InChI Key: | YGLUHMIEECZMPF-UHFFFAOYSA-N | 
 
				 
				