N-(5-chloro-2-methoxyphenyl)-3-(4-fluorophenyl)-3-(1-oxo-1,3-dihydro-2H-isoindol-2-yl)propanamide
Chemical Structure Depiction of
N-(5-chloro-2-methoxyphenyl)-3-(4-fluorophenyl)-3-(1-oxo-1,3-dihydro-2H-isoindol-2-yl)propanamide
N-(5-chloro-2-methoxyphenyl)-3-(4-fluorophenyl)-3-(1-oxo-1,3-dihydro-2H-isoindol-2-yl)propanamide
Compound characteristics
| Compound ID: | E787-0234 |
| Compound Name: | N-(5-chloro-2-methoxyphenyl)-3-(4-fluorophenyl)-3-(1-oxo-1,3-dihydro-2H-isoindol-2-yl)propanamide |
| Molecular Weight: | 438.88 |
| Molecular Formula: | C24 H20 Cl F N2 O3 |
| Smiles: | COc1ccc(cc1NC(CC(c1ccc(cc1)F)N1Cc2ccccc2C1=O)=O)[Cl] |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.3872 |
| logD: | 4.3555 |
| logSw: | -4.7206 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 45.786 |
| InChI Key: | AQDYPGMXOBYTHY-NRFANRHFSA-N |