N-[3-(methylsulfanyl)phenyl]-3-(1-oxo-1,3-dihydro-2H-isoindol-2-yl)-3-(thiophen-2-yl)propanamide
Chemical Structure Depiction of
N-[3-(methylsulfanyl)phenyl]-3-(1-oxo-1,3-dihydro-2H-isoindol-2-yl)-3-(thiophen-2-yl)propanamide
N-[3-(methylsulfanyl)phenyl]-3-(1-oxo-1,3-dihydro-2H-isoindol-2-yl)-3-(thiophen-2-yl)propanamide
Compound characteristics
| Compound ID: | E787-0356 |
| Compound Name: | N-[3-(methylsulfanyl)phenyl]-3-(1-oxo-1,3-dihydro-2H-isoindol-2-yl)-3-(thiophen-2-yl)propanamide |
| Molecular Weight: | 408.54 |
| Molecular Formula: | C22 H20 N2 O2 S2 |
| Smiles: | CSc1cccc(c1)NC(CC(c1cccs1)N1Cc2ccccc2C1=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.2133 |
| logD: | 4.2133 |
| logSw: | -4.3481 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 39.872 |
| InChI Key: | YXARYCUBEARFNH-IBGZPJMESA-N |