N-cyclohexyl-3-(3,4-dimethoxyphenyl)-3-(1-oxo-1,3-dihydro-2H-isoindol-2-yl)propanamide
Chemical Structure Depiction of
N-cyclohexyl-3-(3,4-dimethoxyphenyl)-3-(1-oxo-1,3-dihydro-2H-isoindol-2-yl)propanamide
N-cyclohexyl-3-(3,4-dimethoxyphenyl)-3-(1-oxo-1,3-dihydro-2H-isoindol-2-yl)propanamide
Compound characteristics
| Compound ID: | E787-0576 |
| Compound Name: | N-cyclohexyl-3-(3,4-dimethoxyphenyl)-3-(1-oxo-1,3-dihydro-2H-isoindol-2-yl)propanamide |
| Molecular Weight: | 422.52 |
| Molecular Formula: | C25 H30 N2 O4 |
| Smiles: | COc1ccc(cc1OC)C(CC(NC1CCCCC1)=O)N1Cc2ccccc2C1=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.8928 |
| logD: | 3.8928 |
| logSw: | -3.9894 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 55.162 |
| InChI Key: | DRAWWWJOULMNJC-NRFANRHFSA-N |