3-(4-methoxyphenyl)-N-[(4-methoxyphenyl)methyl]-1H-pyrazole-5-carboxamide
Chemical Structure Depiction of
3-(4-methoxyphenyl)-N-[(4-methoxyphenyl)methyl]-1H-pyrazole-5-carboxamide
3-(4-methoxyphenyl)-N-[(4-methoxyphenyl)methyl]-1H-pyrazole-5-carboxamide
Compound characteristics
| Compound ID: | E822-1537 |
| Compound Name: | 3-(4-methoxyphenyl)-N-[(4-methoxyphenyl)methyl]-1H-pyrazole-5-carboxamide |
| Molecular Weight: | 337.38 |
| Molecular Formula: | C19 H19 N3 O3 |
| Smiles: | COc1ccc(CNC(c2cc(c3ccc(cc3)OC)n[nH]2)=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 3.4222 |
| logD: | 3.4221 |
| logSw: | -3.6829 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 62.229 |
| InChI Key: | IBVIFCZGONUXIY-UHFFFAOYSA-N |