N-[2-(4-chlorophenyl)ethyl]-3-(3-methoxyphenyl)-1H-pyrazole-5-carboxamide
Chemical Structure Depiction of
N-[2-(4-chlorophenyl)ethyl]-3-(3-methoxyphenyl)-1H-pyrazole-5-carboxamide
N-[2-(4-chlorophenyl)ethyl]-3-(3-methoxyphenyl)-1H-pyrazole-5-carboxamide
Compound characteristics
| Compound ID: | E822-1891 |
| Compound Name: | N-[2-(4-chlorophenyl)ethyl]-3-(3-methoxyphenyl)-1H-pyrazole-5-carboxamide |
| Molecular Weight: | 355.82 |
| Molecular Formula: | C19 H18 Cl N3 O2 |
| Smiles: | COc1cccc(c1)c1cc(C(NCCc2ccc(cc2)[Cl])=O)[nH]n1 |
| Stereo: | ACHIRAL |
| logP: | 3.9243 |
| logD: | 3.924 |
| logSw: | -4.4986 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 54.527 |
| InChI Key: | NGEPDOJTMIMADG-UHFFFAOYSA-N |