(3-methylpiperidin-1-yl)(3-phenyl-1H-pyrazol-5-yl)methanone
Chemical Structure Depiction of
(3-methylpiperidin-1-yl)(3-phenyl-1H-pyrazol-5-yl)methanone
(3-methylpiperidin-1-yl)(3-phenyl-1H-pyrazol-5-yl)methanone
Compound characteristics
| Compound ID: | E822-2111 |
| Compound Name: | (3-methylpiperidin-1-yl)(3-phenyl-1H-pyrazol-5-yl)methanone |
| Molecular Weight: | 269.34 |
| Molecular Formula: | C16 H19 N3 O |
| Smiles: | CC1CCCN(C1)C(c1cc(c2ccccc2)n[nH]1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.3067 |
| logD: | 3.3061 |
| logSw: | -3.6482 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 39.31 |
| InChI Key: | ASFXTVYOBLHRFO-LBPRGKRZSA-N |