1-[(4-methoxyphenyl)methyl]-6-methyl-3-({[2-(4-methylphenyl)ethyl]amino}methyl)-1H-indole-2-carboxylic acid
Chemical Structure Depiction of
1-[(4-methoxyphenyl)methyl]-6-methyl-3-({[2-(4-methylphenyl)ethyl]amino}methyl)-1H-indole-2-carboxylic acid
1-[(4-methoxyphenyl)methyl]-6-methyl-3-({[2-(4-methylphenyl)ethyl]amino}methyl)-1H-indole-2-carboxylic acid
Compound characteristics
| Compound ID: | E847-0321 |
| Compound Name: | 1-[(4-methoxyphenyl)methyl]-6-methyl-3-({[2-(4-methylphenyl)ethyl]amino}methyl)-1H-indole-2-carboxylic acid |
| Molecular Weight: | 442.56 |
| Molecular Formula: | C28 H30 N2 O3 |
| Smiles: | Cc1ccc(CCNCc2c3ccc(C)cc3n(Cc3ccc(cc3)OC)c2C(O)=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 4.9383 |
| logD: | 4.9383 |
| logSw: | -4.5532 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 48.028 |
| InChI Key: | VKFZOVQZXYQLII-UHFFFAOYSA-N |