1-[(4-ethenylphenyl)methyl]-3-({[(furan-2-yl)methyl]amino}methyl)-6-methyl-1H-indole-2-carboxylic acid
Chemical Structure Depiction of
1-[(4-ethenylphenyl)methyl]-3-({[(furan-2-yl)methyl]amino}methyl)-6-methyl-1H-indole-2-carboxylic acid
1-[(4-ethenylphenyl)methyl]-3-({[(furan-2-yl)methyl]amino}methyl)-6-methyl-1H-indole-2-carboxylic acid
Compound characteristics
| Compound ID: | E847-0366 |
| Compound Name: | 1-[(4-ethenylphenyl)methyl]-3-({[(furan-2-yl)methyl]amino}methyl)-6-methyl-1H-indole-2-carboxylic acid |
| Molecular Weight: | 400.48 |
| Molecular Formula: | C25 H24 N2 O3 |
| Smiles: | Cc1ccc2c(CNCc3ccco3)c(C(O)=O)n(Cc3ccc(C=C)cc3)c2c1 |
| Stereo: | ACHIRAL |
| logP: | 4.8404 |
| logD: | 4.8404 |
| logSw: | -4.5268 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 48.391 |
| InChI Key: | HODVDNNMWXSWIF-UHFFFAOYSA-N |