N-[2-(2,5-dimethoxyphenyl)ethyl]-2-[5-(piperidine-1-sulfonyl)-1H-indol-1-yl]acetamide
Chemical Structure Depiction of
N-[2-(2,5-dimethoxyphenyl)ethyl]-2-[5-(piperidine-1-sulfonyl)-1H-indol-1-yl]acetamide
N-[2-(2,5-dimethoxyphenyl)ethyl]-2-[5-(piperidine-1-sulfonyl)-1H-indol-1-yl]acetamide
Compound characteristics
| Compound ID: | E848-0498 |
| Compound Name: | N-[2-(2,5-dimethoxyphenyl)ethyl]-2-[5-(piperidine-1-sulfonyl)-1H-indol-1-yl]acetamide |
| Molecular Weight: | 485.6 |
| Molecular Formula: | C25 H31 N3 O5 S |
| Smiles: | COc1ccc(c(CCNC(Cn2ccc3cc(ccc23)S(N2CCCCC2)(=O)=O)=O)c1)OC |
| Stereo: | ACHIRAL |
| logP: | 3.3358 |
| logD: | 3.3358 |
| logSw: | -3.6562 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 73.276 |
| InChI Key: | FTEWRCQVBINUDF-UHFFFAOYSA-N |