4-{[4-([1,4'-bipiperidine]-1'-carbonyl)phenyl]methyl}-2-methyl-6,7-dihydropyrazolo[1,5-a]pyrimidin-5(4H)-one
Chemical Structure Depiction of
4-{[4-([1,4'-bipiperidine]-1'-carbonyl)phenyl]methyl}-2-methyl-6,7-dihydropyrazolo[1,5-a]pyrimidin-5(4H)-one
4-{[4-([1,4'-bipiperidine]-1'-carbonyl)phenyl]methyl}-2-methyl-6,7-dihydropyrazolo[1,5-a]pyrimidin-5(4H)-one
Compound characteristics
| Compound ID: | E856-2178 |
| Compound Name: | 4-{[4-([1,4'-bipiperidine]-1'-carbonyl)phenyl]methyl}-2-methyl-6,7-dihydropyrazolo[1,5-a]pyrimidin-5(4H)-one |
| Molecular Weight: | 435.57 |
| Molecular Formula: | C25 H33 N5 O2 |
| Smiles: | Cc1cc2N(Cc3ccc(cc3)C(N3CCC(CC3)N3CCCCC3)=O)C(CCn2n1)=O |
| Stereo: | ACHIRAL |
| logP: | 2.1718 |
| logD: | -1.2677 |
| logSw: | -2.5609 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 47.84 |
| InChI Key: | XEAWZCLKUMNAEM-UHFFFAOYSA-N |