N-(4-chlorophenyl)-2-methyl-N-(2-{[2-(2-methylphenyl)ethyl]amino}-2-oxoethyl)-5,6-dihydro-1,4-oxathiine-3-carboxamide
Chemical Structure Depiction of
N-(4-chlorophenyl)-2-methyl-N-(2-{[2-(2-methylphenyl)ethyl]amino}-2-oxoethyl)-5,6-dihydro-1,4-oxathiine-3-carboxamide
N-(4-chlorophenyl)-2-methyl-N-(2-{[2-(2-methylphenyl)ethyl]amino}-2-oxoethyl)-5,6-dihydro-1,4-oxathiine-3-carboxamide
Compound characteristics
| Compound ID: | E857-2791 |
| Compound Name: | N-(4-chlorophenyl)-2-methyl-N-(2-{[2-(2-methylphenyl)ethyl]amino}-2-oxoethyl)-5,6-dihydro-1,4-oxathiine-3-carboxamide |
| Molecular Weight: | 444.98 |
| Molecular Formula: | C23 H25 Cl N2 O3 S |
| Smiles: | CC1=C(C(N(CC(NCCc2ccccc2C)=O)c2ccc(cc2)[Cl])=O)SCCO1 |
| Stereo: | ACHIRAL |
| logP: | 3.8867 |
| logD: | 3.8867 |
| logSw: | -4.3186 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 48.173 |
| InChI Key: | QSIRJRKRZIJUOB-UHFFFAOYSA-N |