methyl 2-{[1-(4-methoxyphenyl)-1,3,4,9-tetrahydro-2H-pyrido[3,4-b]indole-2-carbonyl]amino}benzoate
Chemical Structure Depiction of
methyl 2-{[1-(4-methoxyphenyl)-1,3,4,9-tetrahydro-2H-pyrido[3,4-b]indole-2-carbonyl]amino}benzoate
methyl 2-{[1-(4-methoxyphenyl)-1,3,4,9-tetrahydro-2H-pyrido[3,4-b]indole-2-carbonyl]amino}benzoate
Compound characteristics
| Compound ID: | E864-0273 |
| Compound Name: | methyl 2-{[1-(4-methoxyphenyl)-1,3,4,9-tetrahydro-2H-pyrido[3,4-b]indole-2-carbonyl]amino}benzoate |
| Molecular Weight: | 455.51 |
| Molecular Formula: | C27 H25 N3 O4 |
| Smiles: | COC(c1ccccc1NC(N1CCc2c3ccccc3[nH]c2C1c1ccc(cc1)OC)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.3432 |
| logD: | 5.3427 |
| logSw: | -5.7049 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 62.912 |
| InChI Key: | CJXJHTPLHNFXFQ-RUZDIDTESA-N |