6-chloro-N-(3-chloro-2-methylphenyl)-1-(4-methylphenyl)-1,3,4,9-tetrahydro-2H-pyrido[3,4-b]indole-2-carboxamide
Chemical Structure Depiction of
6-chloro-N-(3-chloro-2-methylphenyl)-1-(4-methylphenyl)-1,3,4,9-tetrahydro-2H-pyrido[3,4-b]indole-2-carboxamide
6-chloro-N-(3-chloro-2-methylphenyl)-1-(4-methylphenyl)-1,3,4,9-tetrahydro-2H-pyrido[3,4-b]indole-2-carboxamide
Compound characteristics
| Compound ID: | E864-0525 |
| Compound Name: | 6-chloro-N-(3-chloro-2-methylphenyl)-1-(4-methylphenyl)-1,3,4,9-tetrahydro-2H-pyrido[3,4-b]indole-2-carboxamide |
| Molecular Weight: | 464.39 |
| Molecular Formula: | C26 H23 Cl2 N3 O |
| Smiles: | Cc1ccc(cc1)C1c2c(CCN1C(Nc1cccc(c1C)[Cl])=O)c1cc(ccc1[nH]2)[Cl] |
| Stereo: | RACEMIC MIXTURE |
| logP: | 7.7122 |
| logD: | 7.7122 |
| logSw: | -6.5316 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 34.195 |
| InChI Key: | RZRGWIFDYLZFPK-RUZDIDTESA-N |