1-(4-methoxyphenyl)-4-methyl-2-{2-oxo-2-[4-(pyridin-2-yl)piperazin-1-yl]ethyl}-1,4-dihydropyrrolo[3,4-b]indol-3(2H)-one
Chemical Structure Depiction of
1-(4-methoxyphenyl)-4-methyl-2-{2-oxo-2-[4-(pyridin-2-yl)piperazin-1-yl]ethyl}-1,4-dihydropyrrolo[3,4-b]indol-3(2H)-one
1-(4-methoxyphenyl)-4-methyl-2-{2-oxo-2-[4-(pyridin-2-yl)piperazin-1-yl]ethyl}-1,4-dihydropyrrolo[3,4-b]indol-3(2H)-one
Compound characteristics
| Compound ID: | E865-0405 |
| Compound Name: | 1-(4-methoxyphenyl)-4-methyl-2-{2-oxo-2-[4-(pyridin-2-yl)piperazin-1-yl]ethyl}-1,4-dihydropyrrolo[3,4-b]indol-3(2H)-one |
| Molecular Weight: | 495.58 |
| Molecular Formula: | C29 H29 N5 O3 |
| Smiles: | Cn1c2C(N(CC(N3CCN(CC3)c3ccccn3)=O)C(c3ccc(cc3)OC)c2c2ccccc12)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.7392 |
| logD: | 3.7303 |
| logSw: | -4.0177 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 53.648 |
| InChI Key: | PCESVADWYBDCBO-MHZLTWQESA-N |