6,8-dimethyl-N-(4-{[(thiophen-2-yl)methyl]carbamoyl}phenyl)-2,3-dihydro-1H-pyrido[2,3-b][1,4]thiazine-1-carboxamide
Chemical Structure Depiction of
6,8-dimethyl-N-(4-{[(thiophen-2-yl)methyl]carbamoyl}phenyl)-2,3-dihydro-1H-pyrido[2,3-b][1,4]thiazine-1-carboxamide
6,8-dimethyl-N-(4-{[(thiophen-2-yl)methyl]carbamoyl}phenyl)-2,3-dihydro-1H-pyrido[2,3-b][1,4]thiazine-1-carboxamide
Compound characteristics
| Compound ID: | E867-0857 |
| Compound Name: | 6,8-dimethyl-N-(4-{[(thiophen-2-yl)methyl]carbamoyl}phenyl)-2,3-dihydro-1H-pyrido[2,3-b][1,4]thiazine-1-carboxamide |
| Molecular Weight: | 438.57 |
| Molecular Formula: | C22 H22 N4 O2 S2 |
| Smiles: | Cc1cc(C)nc2c1N(CCS2)C(Nc1ccc(cc1)C(NCc1cccs1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.1235 |
| logD: | 4.1234 |
| logSw: | -4.1431 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 61.388 |
| InChI Key: | QIIMBYNDORUIJV-UHFFFAOYSA-N |