2-{6-[(2-chlorophenyl)methyl]-1,1-dioxo-1lambda~6~,2,6-thiadiazinan-2-yl}-N-(2,4-dimethoxyphenyl)acetamide
Chemical Structure Depiction of
2-{6-[(2-chlorophenyl)methyl]-1,1-dioxo-1lambda~6~,2,6-thiadiazinan-2-yl}-N-(2,4-dimethoxyphenyl)acetamide
2-{6-[(2-chlorophenyl)methyl]-1,1-dioxo-1lambda~6~,2,6-thiadiazinan-2-yl}-N-(2,4-dimethoxyphenyl)acetamide
Compound characteristics
| Compound ID: | E871-0147 |
| Compound Name: | 2-{6-[(2-chlorophenyl)methyl]-1,1-dioxo-1lambda~6~,2,6-thiadiazinan-2-yl}-N-(2,4-dimethoxyphenyl)acetamide |
| Molecular Weight: | 453.94 |
| Molecular Formula: | C20 H24 Cl N3 O5 S |
| Smiles: | COc1ccc(c(c1)OC)NC(CN1CCCN(Cc2ccccc2[Cl])S1(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.7997 |
| logD: | 2.7996 |
| logSw: | -3.4012 |
| Hydrogen bond acceptors count: | 10 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 74.005 |
| InChI Key: | QRSCXVRDBWIDPL-UHFFFAOYSA-N |