N-(2,4-dimethoxyphenyl)-2-{6-[(2,5-dimethylphenyl)methyl]-1,1-dioxo-1lambda~6~,2,6-thiadiazinan-2-yl}acetamide
Chemical Structure Depiction of
N-(2,4-dimethoxyphenyl)-2-{6-[(2,5-dimethylphenyl)methyl]-1,1-dioxo-1lambda~6~,2,6-thiadiazinan-2-yl}acetamide
N-(2,4-dimethoxyphenyl)-2-{6-[(2,5-dimethylphenyl)methyl]-1,1-dioxo-1lambda~6~,2,6-thiadiazinan-2-yl}acetamide
Compound characteristics
| Compound ID: | E871-0267 |
| Compound Name: | N-(2,4-dimethoxyphenyl)-2-{6-[(2,5-dimethylphenyl)methyl]-1,1-dioxo-1lambda~6~,2,6-thiadiazinan-2-yl}acetamide |
| Molecular Weight: | 447.55 |
| Molecular Formula: | C22 H29 N3 O5 S |
| Smiles: | Cc1ccc(C)c(CN2CCCN(CC(Nc3ccc(cc3OC)OC)=O)S2(=O)=O)c1 |
| Stereo: | ACHIRAL |
| logP: | 3.3618 |
| logD: | 3.3617 |
| logSw: | -3.4621 |
| Hydrogen bond acceptors count: | 10 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 74.005 |
| InChI Key: | DAPBVOCMOOITLX-UHFFFAOYSA-N |