2-{6-[(4-chlorophenyl)methyl]-1,1-dioxo-1lambda~6~,2,6-thiadiazinan-2-yl}-N-(3,5-dimethylphenyl)acetamide
Chemical Structure Depiction of
2-{6-[(4-chlorophenyl)methyl]-1,1-dioxo-1lambda~6~,2,6-thiadiazinan-2-yl}-N-(3,5-dimethylphenyl)acetamide
2-{6-[(4-chlorophenyl)methyl]-1,1-dioxo-1lambda~6~,2,6-thiadiazinan-2-yl}-N-(3,5-dimethylphenyl)acetamide
Compound characteristics
| Compound ID: | E871-0530 |
| Compound Name: | 2-{6-[(4-chlorophenyl)methyl]-1,1-dioxo-1lambda~6~,2,6-thiadiazinan-2-yl}-N-(3,5-dimethylphenyl)acetamide |
| Molecular Weight: | 421.94 |
| Molecular Formula: | C20 H24 Cl N3 O3 S |
| Smiles: | Cc1cc(C)cc(c1)NC(CN1CCCN(Cc2ccc(cc2)[Cl])S1(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.7264 |
| logD: | 3.7264 |
| logSw: | -4.143 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 59.528 |
| InChI Key: | APOAMYWHEYDFPN-UHFFFAOYSA-N |