[4-(2,4-dimethoxyanilino)-1-methyl[1,2,4]triazolo[4,3-a]quinoxalin-8-yl](phenyl)methanone
Chemical Structure Depiction of
[4-(2,4-dimethoxyanilino)-1-methyl[1,2,4]triazolo[4,3-a]quinoxalin-8-yl](phenyl)methanone
[4-(2,4-dimethoxyanilino)-1-methyl[1,2,4]triazolo[4,3-a]quinoxalin-8-yl](phenyl)methanone
Compound characteristics
| Compound ID: | E881-0302 |
| Compound Name: | [4-(2,4-dimethoxyanilino)-1-methyl[1,2,4]triazolo[4,3-a]quinoxalin-8-yl](phenyl)methanone |
| Molecular Weight: | 439.47 |
| Molecular Formula: | C25 H21 N5 O3 |
| Smiles: | Cc1nnc2c(Nc3ccc(cc3OC)OC)nc3ccc(cc3n12)C(c1ccccc1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.2455 |
| logD: | 4.2453 |
| logSw: | -4.4295 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 68.193 |
| InChI Key: | VAYMGHQLIAEEGF-UHFFFAOYSA-N |