3-[(2-phenylpropyl)amino]-4-(2,4,5-trimethylphenyl)cyclobut-3-ene-1,2-dione
Chemical Structure Depiction of
3-[(2-phenylpropyl)amino]-4-(2,4,5-trimethylphenyl)cyclobut-3-ene-1,2-dione
3-[(2-phenylpropyl)amino]-4-(2,4,5-trimethylphenyl)cyclobut-3-ene-1,2-dione
Compound characteristics
| Compound ID: | E882-0537 |
| Compound Name: | 3-[(2-phenylpropyl)amino]-4-(2,4,5-trimethylphenyl)cyclobut-3-ene-1,2-dione |
| Molecular Weight: | 333.43 |
| Molecular Formula: | C22 H23 N O2 |
| Smiles: | CC(CNC1=C(C(C1=O)=O)c1cc(C)c(C)cc1C)c1ccccc1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.3989 |
| logD: | 5.3989 |
| logSw: | -5.4693 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 37.216 |
| InChI Key: | DNQSBUAPASYQSY-INIZCTEOSA-N |