N-(2,4-dimethylphenyl)-2-[3'-(4-fluorophenyl)-2,4'-dioxospiro[indole-3,2'-[1,3]thiazolidin]-1(2H)-yl]acetamide
Chemical Structure Depiction of
N-(2,4-dimethylphenyl)-2-[3'-(4-fluorophenyl)-2,4'-dioxospiro[indole-3,2'-[1,3]thiazolidin]-1(2H)-yl]acetamide
N-(2,4-dimethylphenyl)-2-[3'-(4-fluorophenyl)-2,4'-dioxospiro[indole-3,2'-[1,3]thiazolidin]-1(2H)-yl]acetamide
Compound characteristics
| Compound ID: | E897-0382 |
| Compound Name: | N-(2,4-dimethylphenyl)-2-[3'-(4-fluorophenyl)-2,4'-dioxospiro[indole-3,2'-[1,3]thiazolidin]-1(2H)-yl]acetamide |
| Molecular Weight: | 475.54 |
| Molecular Formula: | C26 H22 F N3 O3 S |
| Smiles: | Cc1ccc(c(C)c1)NC(CN1C(C2(c3ccccc13)N(C(CS2)=O)c1ccc(cc1)F)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.1943 |
| logD: | 4.1943 |
| logSw: | -4.2688 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 53.487 |
| InChI Key: | RLEDGBKRGAAOLO-SANMLTNESA-N |