2-[3'-(3,4-dimethylphenyl)-2,4'-dioxospiro[indole-3,2'-[1,3]thiazolidin]-1(2H)-yl]-N-[4-(propan-2-yl)phenyl]acetamide
Chemical Structure Depiction of
2-[3'-(3,4-dimethylphenyl)-2,4'-dioxospiro[indole-3,2'-[1,3]thiazolidin]-1(2H)-yl]-N-[4-(propan-2-yl)phenyl]acetamide
2-[3'-(3,4-dimethylphenyl)-2,4'-dioxospiro[indole-3,2'-[1,3]thiazolidin]-1(2H)-yl]-N-[4-(propan-2-yl)phenyl]acetamide
Compound characteristics
| Compound ID: | E897-0435 |
| Compound Name: | 2-[3'-(3,4-dimethylphenyl)-2,4'-dioxospiro[indole-3,2'-[1,3]thiazolidin]-1(2H)-yl]-N-[4-(propan-2-yl)phenyl]acetamide |
| Molecular Weight: | 499.63 |
| Molecular Formula: | C29 H29 N3 O3 S |
| Smiles: | CC(C)c1ccc(cc1)NC(CN1C(C2(c3ccccc13)N(C(CS2)=O)c1ccc(C)c(C)c1)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 6.1533 |
| logD: | 6.1533 |
| logSw: | -5.4738 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 54.185 |
| InChI Key: | YIOWYWBCNLUSTO-LJAQVGFWSA-N |