2-[3'-(3,4-difluorophenyl)-2,4'-dioxospiro[indole-3,2'-[1,3]thiazolidin]-1(2H)-yl]-N-(2-methylphenyl)acetamide
Chemical Structure Depiction of
2-[3'-(3,4-difluorophenyl)-2,4'-dioxospiro[indole-3,2'-[1,3]thiazolidin]-1(2H)-yl]-N-(2-methylphenyl)acetamide
2-[3'-(3,4-difluorophenyl)-2,4'-dioxospiro[indole-3,2'-[1,3]thiazolidin]-1(2H)-yl]-N-(2-methylphenyl)acetamide
Compound characteristics
| Compound ID: | E897-0527 |
| Compound Name: | 2-[3'-(3,4-difluorophenyl)-2,4'-dioxospiro[indole-3,2'-[1,3]thiazolidin]-1(2H)-yl]-N-(2-methylphenyl)acetamide |
| Molecular Weight: | 479.5 |
| Molecular Formula: | C25 H19 F2 N3 O3 S |
| Smiles: | Cc1ccccc1NC(CN1C(C2(c3ccccc13)N(C(CS2)=O)c1ccc(c(c1)F)F)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.8454 |
| logD: | 3.8454 |
| logSw: | -3.9544 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 53.487 |
| InChI Key: | RADZQOMQQUNSMN-VWLOTQADSA-N |