N-(3,4-dimethoxyphenyl)-3-(4-fluorophenyl)[1,2]oxazolo[5,4-d]pyrimidin-4-amine
Chemical Structure Depiction of
N-(3,4-dimethoxyphenyl)-3-(4-fluorophenyl)[1,2]oxazolo[5,4-d]pyrimidin-4-amine
N-(3,4-dimethoxyphenyl)-3-(4-fluorophenyl)[1,2]oxazolo[5,4-d]pyrimidin-4-amine
Compound characteristics
| Compound ID: | E899-0017 |
| Compound Name: | N-(3,4-dimethoxyphenyl)-3-(4-fluorophenyl)[1,2]oxazolo[5,4-d]pyrimidin-4-amine |
| Molecular Weight: | 366.35 |
| Molecular Formula: | C19 H15 F N4 O3 |
| Smiles: | COc1ccc(cc1OC)Nc1c2c(c3ccc(cc3)F)noc2ncn1 |
| Stereo: | ACHIRAL |
| logP: | 3.4743 |
| logD: | 3.4743 |
| logSw: | -3.984 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 66.962 |
| InChI Key: | MOCXDAKICMPOJP-UHFFFAOYSA-N |