N~1~-benzyl-N~1~-[3-(4-fluorophenyl)[1,2]oxazolo[5,4-d]pyrimidin-4-yl]-N~2~,N~2~-dimethylethane-1,2-diamine
Chemical Structure Depiction of
N~1~-benzyl-N~1~-[3-(4-fluorophenyl)[1,2]oxazolo[5,4-d]pyrimidin-4-yl]-N~2~,N~2~-dimethylethane-1,2-diamine
N~1~-benzyl-N~1~-[3-(4-fluorophenyl)[1,2]oxazolo[5,4-d]pyrimidin-4-yl]-N~2~,N~2~-dimethylethane-1,2-diamine
Compound characteristics
| Compound ID: | E899-0236 |
| Compound Name: | N~1~-benzyl-N~1~-[3-(4-fluorophenyl)[1,2]oxazolo[5,4-d]pyrimidin-4-yl]-N~2~,N~2~-dimethylethane-1,2-diamine |
| Molecular Weight: | 391.45 |
| Molecular Formula: | C22 H22 F N5 O |
| Smiles: | CN(C)CCN(Cc1ccccc1)c1c2c(c3ccc(cc3)F)noc2ncn1 |
| Stereo: | ACHIRAL |
| logP: | 3.9255 |
| logD: | 2.9613 |
| logSw: | -4.1571 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 48.941 |
| InChI Key: | MMCLOWUGDVXJTM-UHFFFAOYSA-N |