1-(3-{[3-(4-fluorophenyl)[1,2]oxazolo[5,4-d]pyrimidin-4-yl]amino}phenyl)ethan-1-one
Chemical Structure Depiction of
1-(3-{[3-(4-fluorophenyl)[1,2]oxazolo[5,4-d]pyrimidin-4-yl]amino}phenyl)ethan-1-one
1-(3-{[3-(4-fluorophenyl)[1,2]oxazolo[5,4-d]pyrimidin-4-yl]amino}phenyl)ethan-1-one
Compound characteristics
| Compound ID: | E899-0241 |
| Compound Name: | 1-(3-{[3-(4-fluorophenyl)[1,2]oxazolo[5,4-d]pyrimidin-4-yl]amino}phenyl)ethan-1-one |
| Molecular Weight: | 348.33 |
| Molecular Formula: | C19 H13 F N4 O2 |
| Smiles: | CC(c1cccc(c1)Nc1c2c(c3ccc(cc3)F)noc2ncn1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.6802 |
| logD: | 3.6802 |
| logSw: | -4.1787 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 65.528 |
| InChI Key: | SLPQYCQJYGTSOT-UHFFFAOYSA-N |