N-(2-ethoxyphenyl)-3-[3-(4-fluorophenyl)-4-oxo[1,2]oxazolo[5,4-d]pyrimidin-5(4H)-yl]-N-methylpropanamide
Chemical Structure Depiction of
N-(2-ethoxyphenyl)-3-[3-(4-fluorophenyl)-4-oxo[1,2]oxazolo[5,4-d]pyrimidin-5(4H)-yl]-N-methylpropanamide
N-(2-ethoxyphenyl)-3-[3-(4-fluorophenyl)-4-oxo[1,2]oxazolo[5,4-d]pyrimidin-5(4H)-yl]-N-methylpropanamide
Compound characteristics
| Compound ID: | E910-0103 |
| Compound Name: | N-(2-ethoxyphenyl)-3-[3-(4-fluorophenyl)-4-oxo[1,2]oxazolo[5,4-d]pyrimidin-5(4H)-yl]-N-methylpropanamide |
| Molecular Weight: | 436.44 |
| Molecular Formula: | C23 H21 F N4 O4 |
| Smiles: | CCOc1ccccc1N(C)C(CCN1C=Nc2c(C1=O)c(c1ccc(cc1)F)no2)=O |
| Stereo: | ACHIRAL |
| logP: | 2.4973 |
| logD: | 2.4973 |
| logSw: | -2.4777 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 69.703 |
| InChI Key: | UPEFNMGPHNHYNA-UHFFFAOYSA-N |