N-(3-chlorophenyl)-N-ethyl-3-[3-(4-fluorophenyl)-4-oxo[1,2]oxazolo[5,4-d]pyrimidin-5(4H)-yl]propanamide
Chemical Structure Depiction of
N-(3-chlorophenyl)-N-ethyl-3-[3-(4-fluorophenyl)-4-oxo[1,2]oxazolo[5,4-d]pyrimidin-5(4H)-yl]propanamide
N-(3-chlorophenyl)-N-ethyl-3-[3-(4-fluorophenyl)-4-oxo[1,2]oxazolo[5,4-d]pyrimidin-5(4H)-yl]propanamide
Compound characteristics
| Compound ID: | E910-0112 |
| Compound Name: | N-(3-chlorophenyl)-N-ethyl-3-[3-(4-fluorophenyl)-4-oxo[1,2]oxazolo[5,4-d]pyrimidin-5(4H)-yl]propanamide |
| Molecular Weight: | 440.86 |
| Molecular Formula: | C22 H18 Cl F N4 O3 |
| Smiles: | CCN(C(CCN1C=Nc2c(C1=O)c(c1ccc(cc1)F)no2)=O)c1cccc(c1)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 3.6148 |
| logD: | 3.6148 |
| logSw: | -4.4314 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 62.772 |
| InChI Key: | IUIKVFGDKDMGNG-UHFFFAOYSA-N |