N-(4-ethylphenyl)-5-(6-oxo-1,6-dihydropyridazin-3-yl)thiophene-2-sulfonamide
Chemical Structure Depiction of
N-(4-ethylphenyl)-5-(6-oxo-1,6-dihydropyridazin-3-yl)thiophene-2-sulfonamide
N-(4-ethylphenyl)-5-(6-oxo-1,6-dihydropyridazin-3-yl)thiophene-2-sulfonamide
Compound characteristics
| Compound ID: | E912-0051 |
| Compound Name: | N-(4-ethylphenyl)-5-(6-oxo-1,6-dihydropyridazin-3-yl)thiophene-2-sulfonamide |
| Molecular Weight: | 361.44 |
| Molecular Formula: | C16 H15 N3 O3 S2 |
| Smiles: | CCc1ccc(cc1)NS(c1ccc(C2C=CC(NN=2)=O)s1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.0092 |
| logD: | 4.0057 |
| logSw: | -3.8948 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 79.044 |
| InChI Key: | ZAZGZHXNGIJKCI-UHFFFAOYSA-N |