ethyl 2,5-dimethyl-4-[(2-phenylpropyl)sulfamoyl]-1H-pyrrole-3-carboxylate
Chemical Structure Depiction of
ethyl 2,5-dimethyl-4-[(2-phenylpropyl)sulfamoyl]-1H-pyrrole-3-carboxylate
ethyl 2,5-dimethyl-4-[(2-phenylpropyl)sulfamoyl]-1H-pyrrole-3-carboxylate
Compound characteristics
| Compound ID: | E912-0967 |
| Compound Name: | ethyl 2,5-dimethyl-4-[(2-phenylpropyl)sulfamoyl]-1H-pyrrole-3-carboxylate |
| Molecular Weight: | 364.46 |
| Molecular Formula: | C18 H24 N2 O4 S |
| Smiles: | CCOC(c1c(c(C)[nH]c1C)S(NCC(C)c1ccccc1)(=O)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.4438 |
| logD: | 3.4436 |
| logSw: | -3.7082 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 73.538 |
| InChI Key: | JKKXVGOUJRXOKL-LBPRGKRZSA-N |