ethyl 4-{[(2,5-dimethoxyphenyl)methyl]sulfamoyl}-2,5-dimethyl-1H-pyrrole-3-carboxylate
Chemical Structure Depiction of
ethyl 4-{[(2,5-dimethoxyphenyl)methyl]sulfamoyl}-2,5-dimethyl-1H-pyrrole-3-carboxylate
ethyl 4-{[(2,5-dimethoxyphenyl)methyl]sulfamoyl}-2,5-dimethyl-1H-pyrrole-3-carboxylate
Compound characteristics
| Compound ID: | E912-1036 |
| Compound Name: | ethyl 4-{[(2,5-dimethoxyphenyl)methyl]sulfamoyl}-2,5-dimethyl-1H-pyrrole-3-carboxylate |
| Molecular Weight: | 396.46 |
| Molecular Formula: | C18 H24 N2 O6 S |
| Smiles: | CCOC(c1c(c(C)[nH]c1C)S(NCc1cc(ccc1OC)OC)(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.5204 |
| logD: | 2.5189 |
| logSw: | -2.8908 |
| Hydrogen bond acceptors count: | 10 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 88.713 |
| InChI Key: | QBVMARVUOKQXPI-UHFFFAOYSA-N |