5-amino-1-[2-(3-chloro-4-methoxyanilino)-2-oxoethyl]-N-(3-fluoro-4-methylphenyl)-1H-1,2,3-triazole-4-carboxamide
Chemical Structure Depiction of
5-amino-1-[2-(3-chloro-4-methoxyanilino)-2-oxoethyl]-N-(3-fluoro-4-methylphenyl)-1H-1,2,3-triazole-4-carboxamide
5-amino-1-[2-(3-chloro-4-methoxyanilino)-2-oxoethyl]-N-(3-fluoro-4-methylphenyl)-1H-1,2,3-triazole-4-carboxamide
Compound characteristics
| Compound ID: | E919-1904 |
| Compound Name: | 5-amino-1-[2-(3-chloro-4-methoxyanilino)-2-oxoethyl]-N-(3-fluoro-4-methylphenyl)-1H-1,2,3-triazole-4-carboxamide |
| Molecular Weight: | 432.84 |
| Molecular Formula: | C19 H18 Cl F N6 O3 |
| Smiles: | Cc1ccc(cc1F)NC(c1c(N)n(CC(Nc2ccc(c(c2)[Cl])OC)=O)nn1)=O |
| Stereo: | ACHIRAL |
| logP: | 2.8491 |
| logD: | 2.8487 |
| logSw: | -3.3304 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 4 |
| Polar surface area: | 100.067 |
| InChI Key: | XBOYTMGGJAPCTL-UHFFFAOYSA-N |